What is the molecular formula of Phenyl 4-hydroxybenzoate?
The molecular formula of Phenyl 4-hydroxybenzoate is C13H10O3.
What is the molecular weight of Phenyl 4-hydroxybenzoate?
The molecular weight of Phenyl 4-hydroxybenzoate is 214.22 g/mol.
What is the IUPAC name of Phenyl 4-hydroxybenzoate?
The IUPAC name of Phenyl 4-hydroxybenzoate is phenyl 4-hydroxybenzoate.
What is the InChI of Phenyl 4-hydroxybenzoate?
The InChI of Phenyl 4-hydroxybenzoate is InChI=1S/C13H10O3/c14-11-8-6-10(7-9-11)13(15)16-12-4-2-1-3-5-12/h1-9,14H.
What is the InChIKey of Phenyl 4-hydroxybenzoate?
The InChIKey of Phenyl 4-hydroxybenzoate is GJLNWLVPAHNBQN-UHFFFAOYSA-N.
What is the canonical SMILES of Phenyl 4-hydroxybenzoate?
The canonical SMILES of Phenyl 4-hydroxybenzoate is C1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)O.
What is the CAS number of Phenyl 4-hydroxybenzoate?
The CAS number of Phenyl 4-hydroxybenzoate is 17696-62-7.
What is the European Community (EC) number of Phenyl 4-hydroxybenzoate?
The European Community (EC) number of Phenyl 4-hydroxybenzoate is 241-698-9.
What is the XLogP3 value of Phenyl 4-hydroxybenzoate?
The XLogP3 value of Phenyl 4-hydroxybenzoate is 3.2.
What is the topological polar surface area of Phenyl 4-hydroxybenzoate?
The topological polar surface area of Phenyl 4-hydroxybenzoate is 46.5Ų.