What is the molecular formula of Peficitinib?
The molecular formula of Peficitinib is C18H22N4O2.
What is the molecular weight of Peficitinib?
The molecular weight of Peficitinib is 326.4 g/mol.
What is the IUPAC name of Peficitinib?
The IUPAC name of Peficitinib is 4-[[(1R,3S)-5-hydroxy-2-adamantyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
What are the synonyms for Peficitinib?
The synonyms for Peficitinib include ASP015K and Peficitinib free base.
When was Peficitinib created?
Peficitinib was created on August 19, 2012.
What is the InChI of Peficitinib?
The InChI of Peficitinib is InChI=1S/C18H22N4O2/c19-16(23)13-8-21-17-12(1-2-20-17)15(13)22-14-10-3-9-4-11(14)7-18(24,5-9)6-10/h1-2,8-11,14,24H,3-7H2,(H2,19,23)(H2,20,21,22)/t9?,10-,11+,14?,18?.
What is the InChIKey of Peficitinib?
The InChIKey of Peficitinib is DREIJXJRTLTGJC-JQCLMNFQSA-N.
What is the canonical SMILES of Peficitinib?
The canonical SMILES of Peficitinib is C1C2CC3CC(C2)(CC1C3NC4=C5C=CNC5=NC=C4C(=O)N).
What is the CAS number of Peficitinib?
The CAS number of Peficitinib is 944118-01-8.