What is the molecular formula of Pamam dendrimergeneration-0.5?
The molecular formula of Pamam dendrimergeneration-0.5 is C14H20N2Na4O8.
What is the molecular weight of Pamam dendrimergeneration-0.5?
The molecular weight of Pamam dendrimergeneration-0.5 is 436.28 g/mol.
What is the IUPAC name of Pamam dendrimergeneration-0.5?
The IUPAC name of Pamam dendrimergeneration-0.5 is tetrasodium;3-[2-[bis(2-carboxylatoethyl)amino]ethyl-(2-carboxylatoethyl)amino]propanoate.
What is the InChI of Pamam dendrimergeneration-0.5?
The InChI of Pamam dendrimergeneration-0.5 is InChI=1S/C14H24N2O8.4Na/c17-11(18)1-5-15(6-2-12(19)20)9-10-16(7-3-13(21)22)8-4-14(23)24;;;;/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24);;;;/q;4*+1/p-4.
What is the InChIKey of Pamam dendrimergeneration-0.5?
The InChIKey of Pamam dendrimergeneration-0.5 is CJVPOGPEEJPBFT-UHFFFAOYSA-J.
What is the canonical SMILES of Pamam dendrimergeneration-0.5?
The canonical SMILES of Pamam dendrimergeneration-0.5 is C(CN(CCC(=O)[O-])CCN(CCC(=O)[O-])CCC(=O)[O-])C(=O)[O-].[Na+].[Na+].[Na+].[Na+].
What is the CAS number of Pamam dendrimergeneration-0.5?
The CAS number of Pamam dendrimergeneration-0.5 is 67874-43-5.
What is the European Community (EC) number of Pamam dendrimergeneration-0.5?
The European Community (EC) number of Pamam dendrimergeneration-0.5 is 267-473-5.
How many hydrogen bond donor counts are there in Pamam dendrimergeneration-0.5?
There are 0 hydrogen bond donor counts in Pamam dendrimergeneration-0.5.
How many hydrogen bond acceptor counts are there in Pamam dendrimergeneration-0.5?
There are 10 hydrogen bond acceptor counts in Pamam dendrimergeneration-0.5.
※ Please kindly note that our products are for research use only.