What is the molecular formula of 3-Fluoro-p-anisidine?
The molecular formula of 3-Fluoro-p-anisidine is C7H8FNO.
What is the molecular weight of 3-Fluoro-p-anisidine?
The molecular weight of 3-Fluoro-p-anisidine is 141.14 g/mol.
What is the IUPAC name of 3-Fluoro-p-anisidine?
The IUPAC name of 3-Fluoro-p-anisidine is 3-fluoro-4-methoxyaniline.
What is the InChI of 3-Fluoro-p-anisidine?
The InChI of 3-Fluoro-p-anisidine is InChI=1S/C7H8FNO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,9H2,1H3.
What is the InChIKey of 3-Fluoro-p-anisidine?
The InChIKey of 3-Fluoro-p-anisidine is LJWAPDSCYTZUJU-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-p-anisidine?
The canonical SMILES of 3-Fluoro-p-anisidine is COC1=C(C=C(C=C1)N)F.
What is the CAS number of 3-Fluoro-p-anisidine?
The CAS number of 3-Fluoro-p-anisidine is 366-99-4.
What is the European Community (EC) number of 3-Fluoro-p-anisidine?
The European Community (EC) number of 3-Fluoro-p-anisidine is 627-615-2.
Is 3-Fluoro-p-anisidine a canonicalized compound?
Yes, 3-Fluoro-p-anisidine is a canonicalized compound.