What is the molecular formula of oxydipropyl dibenzoate?
The molecular formula of oxydipropyl dibenzoate is C20H22O5.
What are the synonyms of oxydipropyl dibenzoate?
The synonyms of oxydipropyl dibenzoate are 27138-31-4, 94-03-1, 1,1'-Oxybis-2-propanol dibenzoate, and 1,1'-Dimethyl-2,2'-oxydiethyl dibenzoate.
What is the molecular weight of oxydipropyl dibenzoate?
The molecular weight of oxydipropyl dibenzoate is 342.4 g/mol.
When was oxydipropyl dibenzoate created?
Oxydipropyl dibenzoate was created on August 8, 2005.
When was oxydipropyl dibenzoate last modified?
Oxydipropyl dibenzoate was last modified on October 21, 2023.
What is the IUPAC name of oxydipropyl dibenzoate?
The IUPAC name of oxydipropyl dibenzoate is 1-(2-benzoyloxypropoxy)propan-2-yl benzoate.
What is the InChI of oxydipropyl dibenzoate?
The InChI of oxydipropyl dibenzoate is InChI=1S/C20H22O5/c1-15(24-19(21)17-9-5-3-6-10-17)13-23-14-16(2)25-20(22)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3.
What is the InChIKey of oxydipropyl dibenzoate?
The InChIKey of oxydipropyl dibenzoate is IZYUWBATGXUSIK-UHFFFAOYSA-N.
What is the CAS number of oxydipropyl dibenzoate?
The CAS number of oxydipropyl dibenzoate is 94-03-1.
What is the physical description of oxydipropyl dibenzoate?
Oxydipropyl dibenzoate is a liquid that can exist in the form of pellets or large crystals.