What is the molecular formula of Otava-bb 1206574?
The molecular formula of Otava-bb 1206574 is C7H8FNO.
When was Otava-bb 1206574 created and last modified?
Otava-bb 1206574 was created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Otava-bb 1206574?
The IUPAC name of Otava-bb 1206574 is O-[(4-fluorophenyl)methyl]hydroxylamine.
What is the InChI of Otava-bb 1206574?
The InChI of Otava-bb 1206574 is InChI=1S/C7H8FNO/c8-7-3-1-6(2-4-7)5-10-9/h1-4H,5,9H2.
What is the molecular weight of Otava-bb 1206574?
The molecular weight of Otava-bb 1206574 is 141.14 g/mol.
How many hydrogen bond donor counts does Otava-bb 1206574 have?
Otava-bb 1206574 has one hydrogen bond donor count.
What is the topological polar surface area of Otava-bb 1206574?
The topological polar surface area of Otava-bb 1206574 is 35.2 Ų.
Is Otava-bb 1206574 a canonicalized compound?
Yes, Otava-bb 1206574 is a canonicalized compound.
What is the XLogP3 value of Otava-bb 1206574?
The XLogP3 value of Otava-bb 1206574 is 1.2.
How many covalently-bonded unit counts does Otava-bb 1206574 have?
Otava-bb 1206574 has 1 covalently-bonded unit count.