What is the PubChem CID of Osthenol?
The PubChem CID of Osthenol is 5320318.
What is the molecular formula of Osthenol?
The molecular formula of Osthenol is C14H14O3.
What is the molecular weight of Osthenol?
The molecular weight of Osthenol is 230.26 g/mol.
What is the IUPAC name of Osthenol?
The IUPAC name of Osthenol is 7-hydroxy-8-(3-methylbut-2-enyl)chromen-2-one.
What is the InChI of Osthenol?
The InChI of Osthenol is InChI=1S/C14H14O3/c1-9(2)3-6-11-12(15)7-4-10-5-8-13(16)17-14(10)11/h3-5,7-8,15H,6H2,1-2H3.
What is the InChIKey of Osthenol?
The InChIKey of Osthenol is RAKJVIPCCGXHHS-UHFFFAOYSA-N.
What is the canonical SMILES of Osthenol?
The canonical SMILES of Osthenol is CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)O)C.
What is the CAS number of Osthenol?
The CAS number of Osthenol is 484-14-0.
What is the ChEMBL ID of Osthenol?
The ChEMBL ID of Osthenol is CHEMBL350475.