What is the molecular formula of Ombrabulin?
The molecular formula of Ombrabulin is C21H26N2O6.
What are the synonyms for Ombrabulin?
The synonyms for Ombrabulin are Ombrabulin, 181816-48-8, AVE8062, and (S,Z)-2-Amino-3-hydroxy-N-(2-methoxy-5-(3,4,5-trimethoxystyryl)phenyl)propanamide.
What is the molecular weight of Ombrabulin?
The molecular weight of Ombrabulin is 402.4 g/mol.
When was Ombrabulin created?
Ombrabulin was created on July 28, 2006.
What is the structure of Ombrabulin derived from?
Ombrabulin is derived from the South African willow bush (Combretum caffrum).
How does Ombrabulin work as an antineoplastic agent?
Ombrabulin binds to the colchicine binding site of endothelial cell tubulin, inhibiting tubulin polymerization and inducing mitotic arrest and apoptosis in endothelial cells. As apoptotic endothelial cells detach from their substrata, tumor blood vessels collapse, leading to tumor necrosis.
What is the IUPAC name of Ombrabulin?
The IUPAC name of Ombrabulin is (2S)-2-amino-3-hydroxy-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]propanamide.
What is the InChIKey of Ombrabulin?
The InChIKey of Ombrabulin is IXWNTLSTOZFSCM-YVACAVLKSA-N.
What is the canonical SMILES representation of Ombrabulin?
The canonical SMILES representation of Ombrabulin is COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)NC(=O)C(CO)N.
What is the CAS number of Ombrabulin?
The CAS number of Ombrabulin is 181816-48-8.