What is the molecular formula of Oleandomycin?
The molecular formula of Oleandomycin is C35H61NO12.
What is the molecular weight of Oleandomycin?
The molecular weight of Oleandomycin is 687.9 g/mol.
When was Oleandomycin created?
Oleandomycin was created on September 16, 2004.
What is Oleandomycin synthesized from?
Oleandomycin is synthesized from strains of Streptomyces antibioticus.
Where is Oleandomycin found?
Oleandomycin is found in Streptomyces antibioticus, Streptomyces scabiei, and Streptomyces cyanogenus.
What is the IUPAC name of Oleandomycin?
The IUPAC name of Oleandomycin is (3R,5S,6S,7R,8S,9R,12R,13R,14S,15R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-hydroxy-8-[(2R,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-5,7,9,12,13,15-hexamethyl-1,11-dioxaspiro[2.13]hexadecane-10,16-dione.
What is the InChI of Oleandomycin?
The InChI of Oleandomycin is InChI=1S/C35H61NO12/c1-16-14-35(15-43-35)32(40)19(4)27(37)18(3)22(7)46-33(41)21(6)31(47-26-13-25(42-11)28(38)23(8)45-26)20(5)30(16)48-34-29(39)24(36(9)10)12-17(2)44-34/h16-31,34,37-39H,12-15H2,1-11H3/t16-,17+,18-,19+,20+,21+,22+,23-,24-,25-,26-,27-,28-,29+,30-,31-,34-,35+/m0/s1.
What is the InChIKey of Oleandomycin?
The InChIKey of Oleandomycin is RZPAKFUAFGMUPI-QESOVKLGSA-N.
What is the CAS number of Oleandomycin?
The CAS number of Oleandomycin is 3922-90-5.
Is Oleandomycin an effective antibiotic?
Oleandomycin is a macrolide antibiotic, but it is less effective than erythromycin.