What is the molecular formula of O-Cymene?
The molecular formula of O-Cymene is C10H14.
What is the molecular weight of O-Cymene?
The molecular weight of O-Cymene is 134.22 g/mol.
Is O-Cymene a natural product?
Yes, O-Cymene is a natural product found in Illicium anisatum, Piper nigrum, and other organisms.
What is the IUPAC name of O-Cymene?
The IUPAC name of O-Cymene is 1-methyl-2-propan-2-ylbenzene.
What is the InChI of O-Cymene?
The InChI of O-Cymene is InChI=1S/C10H14/c1-8(2)10-7-5-4-6-9(10)3/h4-8H,1-3H3.
What is the InChIKey of O-Cymene?
The InChIKey of O-Cymene is WWRCMNKATXZARA-UHFFFAOYSA-N.
What is the Canonical SMILES of O-Cymene?
The Canonical SMILES of O-Cymene is CC1=CC=CC=C1C(C)C.
What is the CAS number of O-Cymene?
The CAS number of O-Cymene is 527-84-4.
How many hydrogen bond donors does O-Cymene have?
O-Cymene does not have any hydrogen bond donors.