What is the molecular formula of Nitrocefin?
The molecular formula of Nitrocefin is C21H16N4O8S2.
What are the synonyms for Nitrocefin?
Some synonyms for Nitrocefin are 41906-86-9 and EWP54G0J8F.
What is the molecular weight of Nitrocefin?
The molecular weight of Nitrocefin is 516.5 g/mol.
What is the IUPAC name of Nitrocefin?
The IUPAC name of Nitrocefin is (6R,7R)-3-[(E)-2-(2,4-dinitrophenyl)ethenyl]-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
What is the InChI of Nitrocefin?
The InChI of Nitrocefin is InChI=1S/C21H16N4O8S2/c26-16(9-14-2-1-7-34-14)22-17-19(27)23-18(21(28)29)12(10-35-20(17)23)4-3-11-5-6-13(24(30)31)8-15(11)25(32)33/h1-8,17,20H,9-10H2,(H,22,26)(H,28,29)/b4-3+/t17-,20-/m1/s1.
What is the color change that Nitrocefin undergoes?
Nitrocefin undergoes a color change as its amide bond is hydrolyzed by beta-lactamase.
What is the use of Nitrocefin in bacterial antibiotic resistance studies?
Nitrocefin is used to detect the presence of beta-lactamase enzymes, an important mediator of bacterial antibiotic resistance.
What are the other identifiers for Nitrocefin?
Some other identifiers for Nitrocefin include CAS number 41906-86-9, UNII EWP54G0J8F, and ChEMBL ID CHEMBL480517.
How many hydrogen bond acceptor counts does Nitrocefin have?
Nitrocefin has 10 hydrogen bond acceptor counts.
Who is the supplier of Nitrocefin?
The supplier of Nitrocefin is not mentioned in the reference.