What is the molecular formula of nitrilotriacetic acid?
The molecular formula of nitrilotriacetic acid is C6H9NO6 N(CH2COOH)3.
What is the molecular weight of nitrilotriacetic acid?
The molecular weight of nitrilotriacetic acid is 191.14 g/mol.
What is the chemical safety summary of nitrilotriacetic acid?
The chemical safety summary of nitrilotriacetic acid states that it is an odorless white solid that sinks in and mixes with water.
What are the synonyms of nitrilotriacetic acid?
The synonyms of nitrilotriacetic acid include NITRILOTRIACETIC ACID, 2,2',2''-nitrilotriacetic acid, Triglycollamic acid, N,N-Bis(carboxymethyl)glycine, and more.
Does nitrilotriacetic acid have any toxic or carcinogenic properties?
Yes, nitrilotriacetic acid is listed as a nephrotoxic agent and a carcinogenic agent.
What is the IUPAC name of nitrilotriacetic acid?
The IUPAC name of nitrilotriacetic acid is 2-[bis(carboxymethyl)amino]acetic acid.
What is the InChIKey of nitrilotriacetic acid?
The InChIKey of nitrilotriacetic acid is MGFYIUFZLHCRTH-UHFFFAOYSA-N.
What is the Canonical SMILES of nitrilotriacetic acid?
The Canonical SMILES of nitrilotriacetic acid is C(C(=O)O)N(CC(=O)O)CC(=O)O.
What is the CAS number of nitrilotriacetic acid?
The CAS number of nitrilotriacetic acid is 139-13-9.
Does nitrilotriacetic acid form stable complexes with Zn2+?
Yes, nitrilotriacetic acid is described as a complexing (sequestering) agent that forms stable complexes with Zn2+.