What is the molecular formula of Nitenpyram?
The molecular formula of Nitenpyram is C11H15ClN4O2.
What is the molecular weight of Nitenpyram?
The molecular weight of Nitenpyram is 270.71 g/mol.
What is the role of Nitenpyram as?
Nitenpyram has a role as a neonicotinoid insecticide.
What is the IUPAC name of Nitenpyram?
The IUPAC name of Nitenpyram is (E)-1-N'-[(6-chloropyridin-3-yl)methyl]-1-N'-ethyl-1-N-methyl-2-nitroethene-1,1-diamine.
What is the InChIKey of Nitenpyram?
The InChIKey of Nitenpyram is CFRPSFYHXJZSBI-DHZHZOJOSA-N.
What is the Canonical SMILES of Nitenpyram?
The Canonical SMILES of Nitenpyram is CCN(CC1=CN=C(C=C1)Cl)C(=C[N+](=O)[O-])NC.
What are the other identifiers for Nitenpyram listed in the reference?
Other identifiers for Nitenpyram include CAS numbers, EC number, UNII, ChEMBL ID, DSSTox Substance ID, KEGG ID, Metabolomics Workbench ID, NCI Thesaurus Code, Nikkaji Number, RXCUI, Wikidata, and Wikipedia.
What is the XLogP3-AA value of Nitenpyram?
The XLogP3-AA value of Nitenpyram is 2.4.
How many hydrogen bond donor counts does Nitenpyram have?
Nitenpyram has 1 hydrogen bond donor count.
How many rotatable bond counts does Nitenpyram have?
Nitenpyram has 5 rotatable bond counts.
How does nitenpyram work as an insecticide?
Nitenpyram is a neonicotinoid insecticide that blocks neural messages and binds tightly in the central nervous system of insects, causing rapid death.
What are some synonyms for nitenpyram?
Some synonyms for nitenpyram include Nitenpyram, (E)-Nitenpyram, and Niterndipoine.
What is the InChIKey for nitenpyram?
The InChIKey for nitenpyram is CFRPSFYHXJZSBI-DHZHZOJOSA-N.
What is the CAS number for nitenpyram?
The CAS number for nitenpyram is 150824-47-8.
What is the XLogP3-AA value for nitenpyram?
The XLogP3-AA value for nitenpyram is 2.4.
What is the ChEMBL ID for nitenpyram?
The ChEMBL ID for nitenpyram is CHEMBL259728.