What is the PubChem CID for Nickel oxalate dihydrate?
The PubChem CID for Nickel oxalate dihydrate is 516789.
What is the molecular formula of Nickel oxalate dihydrate?
The molecular formula of Nickel oxalate dihydrate is C2H4NiO6.
What is the molecular weight of Nickel oxalate dihydrate?
The molecular weight of Nickel oxalate dihydrate is 182.74 g/mol.
What is the IUPAC name of Nickel oxalate dihydrate?
The IUPAC name of Nickel oxalate dihydrate is nickel(2+);oxalate;dihydrate.
What is the InChI of Nickel oxalate dihydrate?
The InChI of Nickel oxalate dihydrate is InChI=1S/C2H2O4.Ni.2H2O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;2*1H2/q;+2;;/p-2.
What is the CAS number of Nickel oxalate dihydrate?
The CAS number of Nickel oxalate dihydrate is 117205-02-4.
How many hydrogen bond donor counts does Nickel oxalate dihydrate have?
Nickel oxalate dihydrate has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Nickel oxalate dihydrate have?
Nickel oxalate dihydrate has 6 hydrogen bond acceptor counts.
What is the topological polar surface area of Nickel oxalate dihydrate?
The topological polar surface area of Nickel oxalate dihydrate is 82.3Ų.
Is Nickel oxalate dihydrate a canonicalized compound?
Yes, Nickel oxalate dihydrate is a canonicalized compound.