What is the molecular formula of NHS-Fluorescein?
The molecular formula of NHS-Fluorescein is C24H15NO7.
What is the PubChem CID of NHS-Fluorescein?
The PubChem CID of NHS-Fluorescein is 53393465.
What is the molecular weight of NHS-Fluorescein?
The molecular weight of NHS-Fluorescein is 429.4 g/mol.
When was NHS-Fluorescein created?
NHS-Fluorescein was created on October 26, 2011.
When was NHS-Fluorescein last modified?
NHS-Fluorescein was last modified on December 30, 2023.
What is the IUPAC name of NHS-Fluorescein?
The IUPAC name of NHS-Fluorescein is (2,5-dioxopyrrolidin-1-yl) 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoate.
What is the InChIKey of NHS-Fluorescein?
The InChIKey of NHS-Fluorescein is VQTBINYMFPKLQD-UHFFFAOYSA-N.
What is the Canonical SMILES of NHS-Fluorescein?
The Canonical SMILES of NHS-Fluorescein is C1CC(=O)N(C1=O)OC(=O)C2=CC=CC=C2C3=C4C=CC(=O)C=C4OC5=C3C=CC(=C5)O.
What is the XLogP3-AA value of NHS-Fluorescein?
The XLogP3-AA value of NHS-Fluorescein is 1.9.
Does NHS-Fluorescein have a defined atom stereocenter count?
No, NHS-Fluorescein does not have a defined atom stereocenter count.