What is the molecular formula of neomycin sulfate?
The molecular formula of neomycin sulfate is C23H46N6O13.
What is the molecular weight of neomycin sulfate?
The molecular weight of neomycin sulfate is 614.6 g/mol.
What is the chemical structure of neomycin sulfate?
The chemical structure of neomycin sulfate is a tetracyclic antibacterial agent derived from neomycin, being a glycoside ester of neamine and neobiosamine B.
What are some synonyms for neomycin sulfate?
Some synonyms for neomycin sulfate are Framycetin, neomycin, NEOMYCIN B, Fradiomycin.
What is the IUPAC name of neomycin sulfate?
The IUPAC name of neomycin sulfate is (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,4S,5R)-4-[(2R,3R,4R,5S,6S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxycyclohexyl]oxyoxane-3,4-diol.
What is the InChI code for neomycin sulfate?
The InChI code for neomycin sulfate is InChI=1S/C23H46N6O13/c24-2-7-13(32)15(34)10(28)21(37-7)40-18-6(27)1-5(26)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(29)16(35)14(33)8(3-25)38-22/h5-23,30-36H,1-4,24-29H2/t5-,6+,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1.
What is the CAS number of neomycin sulfate?
The CAS number of neomycin sulfate is 119-04-0.
What is the role of neomycin sulfate as a drug?
Neomycin sulfate has a role as an antibacterial drug, an allergen, and an Escherichia coli metabolite.
How does neomycin sulfate work as an antibiotic?
Neomycin sulfate mediates its pharmacological action by binding to bacterial ribosomes and inhibiting protein synthesis, which is crucial for the survival of bacteria.
In what forms is neomycin sulfate available for pharmaceutical use?
Neomycin sulfate is available in various forms for pharmaceutical use, including oral solution, otic suspensions (for bacterial infections in the external auditory canal), and ophthalmic preparations (for inflammatory conditions and infections in the eye). It is also available in over-the-counter topical products to prevent minor skin infections.