What is the PubChem CID of Nebivolol?
The PubChem CID of Nebivolol is 71301.
What is the molecular formula of Nebivolol?
The molecular formula of Nebivolol is C22H25F2NO4.
What is the molecular weight of Nebivolol?
The molecular weight of Nebivolol is 405.4 g/mol.
What are the synonyms of Nebivolol?
The synonyms of Nebivolol are Nebivolol 99200-09-6, Narbivolol, 2,2'-Azanediylbis(1-(6-fluorochroman-2-yl)ethanol), and (-)-Nebivolol.
What is the IUPAC name of Nebivolol?
The IUPAC name of Nebivolol is 1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)-2-[[2-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)-2-hydroxyethyl]amino]ethanol.
What is the InChI of Nebivolol?
The InChI of Nebivolol is InChI=1S/C22H25F2NO4/c23-15-3-7-19-13(9-15)1-5-21(28-19)17(26)11-25-12-18(27)22-6-2-14-10-16(24)4-8-20(14)29-22/h3-4,7-10,17-18,21-22,25-27H,1-2,5-6,11-12H2.
What is the InChIKey of Nebivolol?
The InChIKey of Nebivolol is KOHIRBRYDXPAMZ-UHFFFAOYSA-N.
What is the canonical SMILES of Nebivolol?
The canonical SMILES of Nebivolol is C1CC2=C(C=CC(=C2)F)OC1C(CNCC(C3CCC4=C(O3)C=CC(=C4)F)O)O.
What is the CAS number of Nebivolol?
The CAS number of Nebivolol is 99200-09-6.
What is the therapeutic use of Nebivolol?
Nebivolol is a beta-blocker and antihypertensive medication that has additional vasodilatory activity mediated by nitric oxide release. It is used to treat high blood pressure.
What is the common chemistry name of Nebivolol?
The common chemistry name of Nebivolol is Nebivolol.