What is the molecular formula of N-tert-Butoxycarbonyl mirabegron?
The molecular formula of N-tert-Butoxycarbonyl mirabegron is C26H32N4O4S.
What are the synonyms for N-tert-Butoxycarbonyl mirabegron?
The synonyms for N-tert-Butoxycarbonyl mirabegron are N-tert-Butoxycarbonyl Mirabegron, 1329485-55-3, tert-butyl N-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]carbamate, and SCHEMBL17209111.
What is the molecular weight of N-tert-Butoxycarbonyl mirabegron?
The molecular weight of N-tert-Butoxycarbonyl mirabegron is 496.6 g/mol.
What is the IUPAC name of N-tert-Butoxycarbonyl mirabegron?
The IUPAC name of N-tert-Butoxycarbonyl mirabegron is tert-butyl N-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethyl]-N-[(2R)-2-hydroxy-2-phenylethyl]carbamate.
What is the InChI code for N-tert-Butoxycarbonyl mirabegron?
The InChI code for N-tert-Butoxycarbonyl mirabegron is InChI=1S/C26H32N4O4S/c1-26(2,3)34-25(33)30(16-22(31)19-7-5-4-6-8-19)14-13-18-9-11-20(12-10-18)28-23(32)15-21-17-35-24(27)29-21/h4-12,17,22,31H,13-16H2,1-3H3,(H2,27,29)(H,28,32)/t22-/m0/s1.
What is the InChIKey of N-tert-Butoxycarbonyl mirabegron?
The InChIKey of N-tert-Butoxycarbonyl mirabegron is FVQURKCOFMEJLM-QFIPXVFZSA-N.
What are the canonical and isomeric SMILES of N-tert-Butoxycarbonyl mirabegron?
The canonical SMILES of N-tert-Butoxycarbonyl mirabegron is CC(C)(C)OC(=O)N(CCC1=CC=C(C=C1)NC(=O)CC2=CSC(=N2)N)CC(C3=CC=CC=C3)O. The isomeric SMILES of N-tert-Butoxycarbonyl mirabegron is CC(C)(C)OC(=O)N(CCC1=CC=C(C=C1)NC(=O)CC2=CSC(=N2)N)C[C@@H](C3=CC=CC=C3)O.
What is the XLogP3-AA value of N-tert-Butoxycarbonyl mirabegron?
The XLogP3-AA value of N-tert-Butoxycarbonyl mirabegron is 3.4.
How many hydrogen bond donor and acceptor counts does N-tert-Butoxycarbonyl mirabegron have?
N-tert-Butoxycarbonyl mirabegron has 3 hydrogen bond donor counts and 7 hydrogen bond acceptor counts.
What is the topological polar surface area of N-tert-Butoxycarbonyl mirabegron?
The topological polar surface area of N-tert-Butoxycarbonyl mirabegron is 146 ?2.
※ Please kindly note that our products are for research use only.