What is the molecular formula of N,N-Dimethylnonylamine?
The molecular formula of N,N-Dimethylnonylamine is C11H25N.
What is the molecular weight of N,N-Dimethylnonylamine?
The molecular weight of N,N-Dimethylnonylamine is 171.32 g/mol.
What is the IUPAC name of N,N-Dimethylnonylamine?
The IUPAC name of N,N-Dimethylnonylamine is N,N-dimethylnonan-1-amine.
What is the InChI of N,N-Dimethylnonylamine?
The InChI of N,N-Dimethylnonylamine is InChI=1S/C11H25N/c1-4-5-6-7-8-9-10-11-12(2)3/h4-11H2,1-3H3.
What is the InChIKey of N,N-Dimethylnonylamine?
The InChIKey of N,N-Dimethylnonylamine is AMAADDMFZSZCNT-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Dimethylnonylamine?
The canonical SMILES of N,N-Dimethylnonylamine is CCCCCCCCCCN(C)C.
What is the CAS number of N,N-Dimethylnonylamine?
The CAS number of N,N-Dimethylnonylamine is 17373-27-2.
What is the European Community (EC) Number of N,N-Dimethylnonylamine?
The European Community (EC) Number of N,N-Dimethylnonylamine is 628-467-1.
Is N,N-Dimethylnonylamine a canonicalized compound?
Yes, N,N-Dimethylnonylamine is a canonicalized compound.