What is the molecular formula of N,N-Diisopropylaniline?
The molecular formula of N,N-Diisopropylaniline is C12H19N.
What is the molecular weight of N,N-Diisopropylaniline?
The molecular weight of N,N-Diisopropylaniline is 177.29 g/mol.
What is the IUPAC name of N,N-Diisopropylaniline?
The IUPAC name of N,N-Diisopropylaniline is N,N-di(propan-2-yl)aniline.
What is the InChI of N,N-Diisopropylaniline?
The InChI of N,N-Diisopropylaniline is InChI=1S/C12H19N/c1-10(2)13(11(3)4)12-8-6-5-7-9-12/h5-11H,1-4H3.
What is the InChIKey of N,N-Diisopropylaniline?
The InChIKey of N,N-Diisopropylaniline is OVSARSKQWCLSJT-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Diisopropylaniline?
The canonical SMILES of N,N-Diisopropylaniline is CC(C)N(C1=CC=CC=C1)C(C)C.
What is the CAS number of N,N-Diisopropylaniline?
The CAS number of N,N-Diisopropylaniline is 4107-98-6.
What is the European Community (EC) Number of N,N-Diisopropylaniline?
The European Community (EC) Number of N,N-Diisopropylaniline is 625-530-5.
What is the UNII of N,N-Diisopropylaniline?
The UNII of N,N-Diisopropylaniline is KEP9PKA41K.
What is the ChEMBL ID of N,N-Diisopropylaniline?
The ChEMBL ID of N,N-Diisopropylaniline is CHEMBL3185705.