What is the molecular formula of N,N-Diisobutylaniline?
The molecular formula of N,N-Diisobutylaniline is C14H23N.
What is the molecular weight of N,N-Diisobutylaniline?
The molecular weight of N,N-Diisobutylaniline is 205.34 g/mol.
What is the IUPAC name of N,N-Diisobutylaniline?
The IUPAC name of N,N-Diisobutylaniline is N,N-bis(2-methylpropyl)aniline.
What is the InChI of N,N-Diisobutylaniline?
The InChI of N,N-Diisobutylaniline is InChI=1S/C14H23N/c1-12(2)10-15(11-13(3)4)14-8-6-5-7-9-14/h5-9,12-13H,10-11H2,1-4H3.
What is the InChIKey of N,N-Diisobutylaniline?
The InChIKey of N,N-Diisobutylaniline is LMOOEMRNWCISOX-UHFFFAOYSA-N.
What is the CAS number of N,N-Diisobutylaniline?
The CAS number of N,N-Diisobutylaniline is 13369-17-0.
What is the XLogP3-AA value of N,N-Diisobutylaniline?
The XLogP3-AA value of N,N-Diisobutylaniline is 4.7.
How many hydrogen bond donor count does N,N-Diisobutylaniline have?
N,N-Diisobutylaniline has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does N,N-Diisobutylaniline have?
N,N-Diisobutylaniline has 1 hydrogen bond acceptor count.
How many rotatable bond count does N,N-Diisobutylaniline have?
N,N-Diisobutylaniline has 5 rotatable bond count.