What is the molecular formula of N,N-Diethyl-p-phenylenediamine sulfate?
The molecular formula of N,N-Diethyl-p-phenylenediamine sulfate is C10H18N2O4S.
What is the molecular weight of N,N-Diethyl-p-phenylenediamine sulfate?
The molecular weight of N,N-Diethyl-p-phenylenediamine sulfate is 262.33 g/mol.
What is the IUPAC name of N,N-Diethyl-p-phenylenediamine sulfate?
The IUPAC name of N,N-Diethyl-p-phenylenediamine sulfate is 4-N,4-N-diethylbenzene-1,4-diamine;sulfuric acid.
What is the InChI of N,N-Diethyl-p-phenylenediamine sulfate?
The InChI of N,N-Diethyl-p-phenylenediamine sulfate is InChI=1S/C10H16N2.H2O4S/c1-3-12(4-2)10-7-5-9(11)6-8-10;1-5(2,3)4/h5-8H,3-4,11H2,1-2H3;(H2,1,2,3,4).
What is the InChIKey of N,N-Diethyl-p-phenylenediamine sulfate?
The InChIKey of N,N-Diethyl-p-phenylenediamine sulfate is AYLDJQABCMPYEN-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Diethyl-p-phenylenediamine sulfate?
The canonical SMILES of N,N-Diethyl-p-phenylenediamine sulfate is CCN(CC)C1=CC=C(C=C1)N.OS(=O)(=O)O.
What is the CAS number of N,N-Diethyl-p-phenylenediamine sulfate?
The CAS number of N,N-Diethyl-p-phenylenediamine sulfate is 6283-63-2.
How many hydrogen bond donor count does N,N-Diethyl-p-phenylenediamine sulfate have?
N,N-Diethyl-p-phenylenediamine sulfate has 3 hydrogen bond donor count.
How many hydrogen bond acceptor count does N,N-Diethyl-p-phenylenediamine sulfate have?
N,N-Diethyl-p-phenylenediamine sulfate has 6 hydrogen bond acceptor count.
How many rotatable bond count does N,N-Diethyl-p-phenylenediamine sulfate have?
N,N-Diethyl-p-phenylenediamine sulfate has 3 rotatable bond count.
※ Please kindly note that our products are for research use only.