What is the molecular formula of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The molecular formula is C10H24Cl2N2.
What is the molecular weight of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The molecular weight is 243.21 g/mol.
What are some synonyms for N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
Some synonyms include trans-N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride, N,N-DIETHYL-CYCLOHEXANE-1,4-DIAMINE DIHYDROCHLORIDE, and N1,N1-diethylcyclohexane-1,4-diamine dihydrochloride.
What is the IUPAC name of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The IUPAC name is 4-N,4-N-diethylcyclohexane-1,4-diamine;dihydrochloride.
What is the InChI code of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The InChI code is InChI=1S/C10H22N2.2ClH/c1-3-12(4-2)10-7-5-9(11)6-8-10;;/h9-10H,3-8,11H2,1-2H3;2*1H.
What is the Canonical SMILES of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The Canonical SMILES is CCN(CC)C1CCC(CC1)N.Cl.Cl.
What is the hydrogen bond donor count of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The hydrogen bond donor count is 3.
What is the hydrogen bond acceptor count of N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride?
The hydrogen bond acceptor count is 2.
How many rotatable bonds does N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride have?
It has 3 rotatable bonds.
Is N,N-Diethyl-cyclohexane-1,4-diamine dihydrochloride categorized as a canonicalized compound?
Yes, it is categorized as a canonicalized compound.
※ Please kindly note that our products are for research use only.