What is the PubChem CID of TPT1?
The PubChem CID of TPT1 is 90922836.
What is the molecular formula of TPT1?
The molecular formula of TPT1 is C72H56N4.
What are the synonyms of TPT1?
The synonyms of TPT1 are N4,N4'-(biphenyl-4,4'-diyl)bis(N4,N4',N4'-triphenylbiphenyl-4,4'-diamine 4,4'-diamine), SCHEMBL17885890, N4',N4'-triphenylbiphenyl.
What is the molecular weight of TPT1?
The molecular weight of TPT1 is 977.2 g/mol.
When was TPT1 created in PubChem?
TPT1 was created in PubChem on March 17, 2015.
When was TPT1 last modified in PubChem?
TPT1 was last modified in PubChem on December 30, 2023.
What is the IUPAC name of TPT1?
The IUPAC name of TPT1 is N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-[4-[4-(N-[4-[4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline.
What is the InChI key of TPT1?
The InChI key of TPT1 is ZBZXYUYUUDZCNB-UHFFFAOYSA-N.
What is the canonical SMILES of TPT1?
The canonical SMILES of TPT1 is C1CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=C(C=C7)N(C8=CC=CC=C8)C9=CC=C(C=C9)C1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1.
What is the XLogP3-AA value of TPT1?
The XLogP3-AA value of TPT1 is 19.7.