What is the molecular formula of N-Methyldiphenylamine?
The molecular formula of N-Methyldiphenylamine is C13H13N.
What is the molecular weight of N-Methyldiphenylamine?
The molecular weight of N-Methyldiphenylamine is 183.25 g/mol.
What is the IUPAC name of N-Methyldiphenylamine?
The IUPAC name of N-Methyldiphenylamine is N-methyl-N-phenylaniline.
What is the InChI of N-Methyldiphenylamine?
The InChI of N-Methyldiphenylamine is InChI=1S/C13H13N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What is the InChIKey of N-Methyldiphenylamine?
The InChIKey of N-Methyldiphenylamine is DYFFAVRFJWYYQO-UHFFFAOYSA-N.
What is the CAS number of N-Methyldiphenylamine?
The CAS number of N-Methyldiphenylamine is 552-82-9.
How many hydrogen bond donor counts does N-Methyldiphenylamine have?
N-Methyldiphenylamine has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does N-Methyldiphenylamine have?
N-Methyldiphenylamine has 1 hydrogen bond acceptor count.
How many rotatable bond counts does N-Methyldiphenylamine have?
N-Methyldiphenylamine has 2 rotatable bond counts.
What is the topological polar surface area of N-Methyldiphenylamine?
The topological polar surface area of N-Methyldiphenylamine is 3.2Ų.