What is the Molecular Formula of N-Methyl-3-chloroaniline?
The Molecular Formula of N-Methyl-3-chloroaniline is C7H8ClN.
What are the Synonyms of N-Methyl-3-chloroaniline?
The synonyms of N-Methyl-3-chloroaniline are 3-chloro-N-methylaniline, 7006-52-2, N-Methyl-3-chloroaniline.
What is the Molecular Weight of N-Methyl-3-chloroaniline?
The Molecular Weight of N-Methyl-3-chloroaniline is 141.60 g/mol.
What is the IUPAC Name of N-Methyl-3-chloroaniline?
The IUPAC Name of N-Methyl-3-chloroaniline is 3-chloro-N-methylaniline.
What is the InChI of N-Methyl-3-chloroaniline?
The InChI of N-Methyl-3-chloroaniline is InChI=1S/C7H8ClN/c1-9-7-4-2-3-6(8)5-7/h2-5,9H,1H3.
What is the InChIKey of N-Methyl-3-chloroaniline?
The InChIKey of N-Methyl-3-chloroaniline is WFGYSQDPURFIFL-UHFFFAOYSA-N.
What is the Canonical SMILES of N-Methyl-3-chloroaniline?
The Canonical SMILES of N-Methyl-3-chloroaniline is CNC1=CC(=CC=C1)Cl.
What is the CAS number of N-Methyl-3-chloroaniline?
The CAS number of N-Methyl-3-chloroaniline is 7006-52-2.
Is N-Methyl-3-chloroaniline canonicalized by PubChem?
Yes, N-Methyl-3-chloroaniline is canonicalized by PubChem.