What is the molecular formula of N-Isopropylbenzylamine?
The molecular formula of N-Isopropylbenzylamine is C10H15N.
What is the molecular weight of N-Isopropylbenzylamine?
The molecular weight of N-Isopropylbenzylamine is 149.23 g/mol.
What is the IUPAC name of N-Isopropylbenzylamine?
The IUPAC name of N-Isopropylbenzylamine is N-benzylpropan-2-amine.
What is the InChI of N-Isopropylbenzylamine?
The InChI of N-Isopropylbenzylamine is InChI=1S/C10H15N/c1-9(2)11-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3.
What is the InChIKey of N-Isopropylbenzylamine?
The InChIKey of N-Isopropylbenzylamine is LYBKPDDZTNUNNM-UHFFFAOYSA-N.
What is the canonical SMILES of N-Isopropylbenzylamine?
The canonical SMILES of N-Isopropylbenzylamine is CC(C)NCC1=CC=CC=C1.
What is the CAS number of N-Isopropylbenzylamine?
The CAS number of N-Isopropylbenzylamine is 102-97-6.
How many hydrogen bond donor counts does N-Isopropylbenzylamine have?
N-Isopropylbenzylamine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does N-Isopropylbenzylamine have?
N-Isopropylbenzylamine has 1 hydrogen bond acceptor count.