What is the molecular formula of N-Cbz-L-phenylalanine?
The molecular formula of N-Cbz-L-phenylalanine is C17H17NO4.
What is the molecular weight of N-Cbz-L-phenylalanine?
The molecular weight of N-Cbz-L-phenylalanine is 299.32 g/mol.
What is the IUPAC name of N-Cbz-L-phenylalanine?
The IUPAC name of N-Cbz-L-phenylalanine is (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid.
What is the InChI of N-Cbz-L-phenylalanine?
The InChI of N-Cbz-L-phenylalanine is InChI=1S/C17H17NO4/c19-16(20)15(11-13-7-3-1-4-8-13)18-17(21)22-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,18,21)(H,19,20)/t15-/m0/s1.
What is the InChIKey of N-Cbz-L-phenylalanine?
The InChIKey of N-Cbz-L-phenylalanine is RRONHWAVOYADJL-HNNXBMFYSA-N.
What is the canonical SMILES of N-Cbz-L-phenylalanine?
The canonical SMILES of N-Cbz-L-phenylalanine is C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2=CC=CC=C2.
How many hydrogen bond donor counts does N-Cbz-L-phenylalanine have?
N-Cbz-L-phenylalanine has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does N-Cbz-L-phenylalanine have?
N-Cbz-L-phenylalanine has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does N-Cbz-L-phenylalanine have?
N-Cbz-L-phenylalanine has 7 rotatable bond counts.
What is the topological polar surface area of N-Cbz-L-phenylalanine?
The topological polar surface area of N-Cbz-L-phenylalanine is 75.6 ?2.