What is the molecular formula of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The molecular formula is C9H18BNO4.
What is the synonyms for N-boc-pyrrolidin-2-(R)-ylboronic acid?
The synonyms are N-Boc-Pyrrolidin-2-(R)-ylboronic acid, (R)-(1-(tert-Butoxycarbonyl)pyrrolidin-2-yl)boronic acid, (R)-N-Boc-pyrrolidin-2-ylboronic acid, and [(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boronic acid.
What is the molecular weight of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The molecular weight is 215.06 g/mol.
What is the IUPAC name of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The IUPAC name is [(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]boronic acid.
What is the InChI of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The InChI is InChI=1S/C9H18BNO4/c1-9(2,3)15-8(12)11-6-4-5-7(11)10(13)14/h7,13-14H,4-6H2,1-3H3/t7-/m0/s1.
What is the InChIKey of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The InChIKey is UIIUYLRUCQCTST-ZETCQYMHSA-N.
What is the canonical SMILES of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The canonical SMILES is B(C1CCCN1C(=O)OC(C)(C)C)(O)O.
What is the isomeric SMILES of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The isomeric SMILES is B([C@@H]1CCCN1C(=O)OC(C)(C)C)(O)O.
What is the CAS number of N-boc-pyrrolidin-2-(R)-ylboronic acid?
The CAS number is 149716-78-9.
Is N-boc-pyrrolidin-2-(R)-ylboronic acid a canonicalized compound?
Yes, N-boc-pyrrolidin-2-(R)-ylboronic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.