What is the molecular formula of N-Boc-3-iodoaniline?
The molecular formula of N-Boc-3-iodoaniline is C11H14INO2.
What is the molecular weight of N-Boc-3-iodoaniline?
The molecular weight of N-Boc-3-iodoaniline is 319.14 g/mol.
What is the IUPAC name of N-Boc-3-iodoaniline?
The IUPAC name of N-Boc-3-iodoaniline is tert-butyl N-(3-iodophenyl)carbamate.
What is the InChI of N-Boc-3-iodoaniline?
The InChI of N-Boc-3-iodoaniline is InChI=1S/C11H14INO2/c1-11(2,3)15-10(14)13-9-6-4-5-8(12)7-9/h4-7H,1-3H3,(H,13,14).
What is the InChIKey of N-Boc-3-iodoaniline?
The InChIKey of N-Boc-3-iodoaniline is MPCQRNOVFYBCTQ-UHFFFAOYSA-N.
What is the canonical SMILES of N-Boc-3-iodoaniline?
The canonical SMILES of N-Boc-3-iodoaniline is CC(C)(C)OC(=O)NC1=CC(=CC=C1)I.
What is the CAS number of N-Boc-3-iodoaniline?
The CAS number of N-Boc-3-iodoaniline is 143390-49-2.
What is the European Community (EC) number of N-Boc-3-iodoaniline?
The European Community (EC) number of N-Boc-3-iodoaniline is 802-983-9.
What is the molecular weight of N-Boc-3-iodoaniline according to PubChem?
The molecular weight of N-Boc-3-iodoaniline is 319.14 g/mol according to PubChem.
Is N-Boc-3-iodoaniline considered as a canonicalized compound?
Yes, N-Boc-3-iodoaniline is considered as a canonicalized compound according to PubChem.