What is the PubChem CID for N-Benzylmethacrylamide?
PubChem CID 76691
What is the molecular formula of N-Benzylmethacrylamide?
The molecular formula is C11H13NO.
What is the molecular weight of N-Benzylmethacrylamide?
The molecular weight is 175.23 g/mol.
What is the IUPAC name of N-Benzylmethacrylamide?
The IUPAC name is N-benzyl-2-methylprop-2-enamide.
What is the InChI of N-Benzylmethacrylamide?
The InChI is InChI=1S/C11H13NO/c1-9(2)11(13)12-8-10-6-4-3-5-7-10/h3-7H,1,8H2,2H3,(H,12,13).
What is the InChIKey of N-Benzylmethacrylamide?
The InChIKey is CEBFLGHPYLIZSC-UHFFFAOYSA-N.
What is the canonical SMILES of N-Benzylmethacrylamide?
The canonical SMILES is CC(=C)C(=O)NCC1=CC=CC=C1.
What is CAS number of N-Benzylmethacrylamide?
The CAS number is 3219-55-4.
What is the EC number of N-Benzylmethacrylamide?
The EC number is 221-744-4.
Is N-Benzylmethacrylamide a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.