What is the molecular formula of N-Benzylcyclopropylamine?
The molecular formula of N-Benzylcyclopropylamine is C10H13N.
What is the molecular weight of N-Benzylcyclopropylamine?
The molecular weight of N-Benzylcyclopropylamine is 147.22 g/mol.
What is the IUPAC name of N-Benzylcyclopropylamine?
The IUPAC name of N-Benzylcyclopropylamine is N-benzylcyclopropanamine.
What is the InChI of N-Benzylcyclopropylamine?
The InChI of N-Benzylcyclopropylamine is InChI=1S/C10H13N/c1-2-4-9(5-3-1)8-11-10-6-7-10/h1-5,10-11H,6-8H2.
What is the InChIKey of N-Benzylcyclopropylamine?
The InChIKey of N-Benzylcyclopropylamine is USBAUXJPPHVCTF-UHFFFAOYSA-N.
What is the canonical SMILES of N-Benzylcyclopropylamine?
The canonical SMILES of N-Benzylcyclopropylamine is C1CC1NCC2=CC=CC=C2.
What is the CAS number of N-Benzylcyclopropylamine?
The CAS number of N-Benzylcyclopropylamine is 13324-66-8.
What is the ChEMBL ID of N-Benzylcyclopropylamine?
The ChEMBL ID of N-Benzylcyclopropylamine is CHEMBL27700.
What is the hydrogen bond donor count of N-Benzylcyclopropylamine?
The hydrogen bond donor count of N-Benzylcyclopropylamine is 1.
Is N-Benzylcyclopropylamine a canonicalized compound?
Yes, N-Benzylcyclopropylamine is a canonicalized compound according to PubChem.