The molecular formula of the compound is C25H52N2O3.
What is the molecular weight of the compound?
The molecular weight of the compound is 428.7 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is acetic acid;N-[3-(dimethylamino)propyl]octadecanamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C23H48N2O.C2H4O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23(26)24-21-19-22-25(2)3;1-2(3)4/h4-22H2,1-3H3,(H,24,26);1H3,(H,3,4).
What is the InChIKey of the compound?
The InChIKey of the compound is PKRDZHPWYDJXPO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCCCCCCCCCCCCCCCC(=O)NCCCN(C)C.CC(=O)O.
What is the CAS number of the compound?
The CAS number of the compound is 13282-70-7.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 20 rotatable bond counts.
※ Please kindly note that our products are for research use only.