What is the molecular formula of Metribuzin DA?
The molecular formula of Metribuzin DA is C8H13N3OS.
What are the synonyms of Metribuzin DA?
The synonyms of Metribuzin DA are 35045-02-4, METRIBUZIN-DESAMINO, Deaminated sencor, DEAMINOMETRIBUZIN, and Metribuzin da.
What is the molecular weight of Metribuzin DA?
The molecular weight of Metribuzin DA is 199.28 g/mol.
What is the IUPAC name of Metribuzin DA?
The IUPAC name of Metribuzin DA is 6-tert-butyl-3-methylsulfanyl-4H-1,2,4-triazin-5-one.
What is the InChI of Metribuzin DA?
The InChI of Metribuzin DA is InChI=1S/C8H13N3OS/c1-8(2,3)5-6(12)9-7(13-4)11-10-5/h1-4H3,(H,9,11,12).
What is the InChIKey of Metribuzin DA?
The InChIKey of Metribuzin DA is MIWRSUQXSCLDNV-UHFFFAOYSA-N.
What is the canonical SMILES of Metribuzin DA?
The canonical SMILES of Metribuzin DA is CC(C)(C)C1=NN=C(NC1=O)SC.
What is the CAS number of Metribuzin DA?
The CAS number of Metribuzin DA is 35045-02-4.
What is the XLogP3-AA value of Metribuzin DA?
The XLogP3-AA value of Metribuzin DA is 1.7.
What is the topological polar surface area of Metribuzin DA?
The topological polar surface area of Metribuzin DA is 79.1 Ų.