What is the molecular formula of Methylmalondialdehyde?
The molecular formula of Methylmalondialdehyde is C4H6O2.
What is the molecular weight of Methylmalondialdehyde?
The molecular weight of Methylmalondialdehyde is 86.09 g/mol.
When was Methylmalondialdehyde created in PubChem?
Methylmalondialdehyde was created in PubChem on March 26, 2005.
What is the IUPAC name of Methylmalondialdehyde?
The IUPAC name of Methylmalondialdehyde is 2-methylpropanedial.
What is the InChI of Methylmalondialdehyde?
The InChI of Methylmalondialdehyde is InChI=1S/C4H6O2/c1-4(2-5)3-6/h2-4H,1H3.
What is the InChIKey of Methylmalondialdehyde?
The InChIKey of Methylmalondialdehyde is VXYSFSCCSQAYJV-UHFFFAOYSA-N.
What is the canonical SMILES of Methylmalondialdehyde?
The canonical SMILES of Methylmalondialdehyde is CC(C=O)C=O.
What is the CAS number of Methylmalondialdehyde?
The CAS number of Methylmalondialdehyde is 16002-19-0.
What is the UNII of Methylmalondialdehyde?
The UNII of Methylmalondialdehyde is N9Y140NWK2.
What is the hydrogen bond donor count of Methylmalondialdehyde?
The hydrogen bond donor count of Methylmalondialdehyde is 0.