What is the molecular formula of methyl ricinoleate?
The molecular formula of methyl ricinoleate is C19H36O3.
What is the molecular weight of methyl ricinoleate?
The molecular weight of methyl ricinoleate is 312.5 g/mol.
What is the IUPAC name of methyl ricinoleate?
The IUPAC name of methyl ricinoleate is methyl (Z,12R)-12-hydroxyoctadec-9-enoate.
What is the InChI of methyl ricinoleate?
The InChI of methyl ricinoleate is InChI=1S/C19H36O3/c1-3-4-5-12-15-18(20)16-13-10-8-6-7-9-11-14-17-19(21)22-2/h10,13,18,20H,3-9,11-12,14-17H2,1-2H3/b13-10-/t18-/m1/s1.
What is the InChIKey of methyl ricinoleate?
The InChIKey of methyl ricinoleate is XKGDWZQXVZSXAO-ADYSOMBNSA-N.
What is the canonical SMILES of methyl ricinoleate?
The canonical SMILES of methyl ricinoleate is CCCCCCC(CC=CCCCCCCCC(=O)OC)O.
What are the synonyms for methyl ricinoleate?
The synonyms for methyl ricinoleate include Ricinoleic acid methyl ester, Flexricin P-1, and Methyl ricinolate.
What is the CAS number of methyl ricinoleate?
The CAS number of methyl ricinoleate is 141-24-2.
What is the XLogP3-AA value of methyl ricinoleate?
The XLogP3-AA value of methyl ricinoleate is 6.1.
What is the hydrogen bond donor count of methyl ricinoleate?
The hydrogen bond donor count of methyl ricinoleate is 1.