What is the molecular formula of methyl linoleate?
The molecular formula of methyl linoleate is C19H34O2.
What is the molecular weight of methyl linoleate?
The molecular weight of methyl linoleate is 294.5 g/mol.
What is the IUPAC name of methyl linoleate?
The IUPAC name of methyl linoleate is methyl (9Z,12Z)-octadeca-9,12-dienoate.
What is the InChI key of methyl linoleate?
The InChI key of methyl linoleate is WTTJVINHCBCLGX-NQLNTKRDSA-N.
What is the canonical SMILES of methyl linoleate?
The canonical SMILES of methyl linoleate is CCCCCC=CCC=CCCCCCCCC(=O)OC.
What is the isomeric SMILES of methyl linoleate?
The isomeric SMILES of methyl linoleate is CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC.
What is the CAS number of methyl linoleate?
The CAS number of methyl linoleate is 112-63-0.
What is the XLogP3-AA value of methyl linoleate?
The XLogP3-AA value of methyl linoleate is 6.9.
How many hydrogen bond acceptor counts does methyl linoleate have?
Methyl linoleate has 2 hydrogen bond acceptor counts.
What is the topological polar surface area of methyl linoleate?
The topological polar surface area of methyl linoleate is 26.3Ų.