What is the molecular formula of Methyl 4-methoxy-2-indolecarboxylate?
The molecular formula of Methyl 4-methoxy-2-indolecarboxylate is C11H11NO3.
What are the synonyms of Methyl 4-methoxy-2-indolecarboxylate?
The synonyms of Methyl 4-methoxy-2-indolecarboxylate include methyl 4-methoxy-1H-indole-2-carboxylate, 111258-23-2, and methyl 4-methoxyindole-2-carboxylate.
What is the molecular weight of Methyl 4-methoxy-2-indolecarboxylate?
The molecular weight of Methyl 4-methoxy-2-indolecarboxylate is 205.21 g/mol.
What is the IUPAC name of Methyl 4-methoxy-2-indolecarboxylate?
The IUPAC name of Methyl 4-methoxy-2-indolecarboxylate is methyl 4-methoxy-1H-indole-2-carboxylate.
What is the InChI of Methyl 4-methoxy-2-indolecarboxylate?
The InChI of Methyl 4-methoxy-2-indolecarboxylate is InChI=1S/C11H11NO3/c1-14-10-5-3-4-8-7(10)6-9(12-8)11(13)15-2/h3-6,12H,1-2H3.
What is the InChIKey of Methyl 4-methoxy-2-indolecarboxylate?
The InChIKey of Methyl 4-methoxy-2-indolecarboxylate is GLCZQTLCVLVFGV-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 4-methoxy-2-indolecarboxylate?
The canonical SMILES of Methyl 4-methoxy-2-indolecarboxylate is COC1=CC=CC2=C1C=C(N2)C(=O)OC.
What is the XLogP3 value of Methyl 4-methoxy-2-indolecarboxylate?
The XLogP3 value of Methyl 4-methoxy-2-indolecarboxylate is 2.4.
How many hydrogen bond donor atoms are there in Methyl 4-methoxy-2-indolecarboxylate?
There is 1 hydrogen bond donor atom in Methyl 4-methoxy-2-indolecarboxylate.
How many hydrogen bond acceptor atoms are there in Methyl 4-methoxy-2-indolecarboxylate?
There are 3 hydrogen bond acceptor atoms in Methyl 4-methoxy-2-indolecarboxylate.
※ Please kindly note that our products are for research use only.