What is the molecular formula of Methyl 3-Bromopropionate?
The molecular formula of Methyl 3-Bromopropionate is C4H7BrO2.
What is the molecular weight of Methyl 3-Bromopropionate?
The molecular weight of Methyl 3-Bromopropionate is 167.00 g/mol.
What is the IUPAC name of Methyl 3-Bromopropionate?
The IUPAC name of Methyl 3-Bromopropionate is methyl 3-bromopropanoate.
What is the InChI of Methyl 3-Bromopropionate?
The InChI of Methyl 3-Bromopropionate is InChI=1S/C4H7BrO2/c1-7-4(6)2-3-5/h2-3H2,1H3.
What is the InChIKey of Methyl 3-Bromopropionate?
The InChIKey of Methyl 3-Bromopropionate is KQEVIFKPZOGBMZ-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 3-Bromopropionate?
The canonical SMILES of Methyl 3-Bromopropionate is COC(=O)CCBr.
What is the CAS number of Methyl 3-Bromopropionate?
The CAS number of Methyl 3-Bromopropionate is 3395-91-3.
What is the European Community (EC) number of Methyl 3-Bromopropionate?
The European Community (EC) number of Methyl 3-Bromopropionate is 222-247-5.
What is the UNII of Methyl 3-Bromopropionate?
The UNII of Methyl 3-Bromopropionate is Y803CH1P4W.
Is Methyl 3-Bromopropionate a canonicalized compound?
Yes, Methyl 3-Bromopropionate is a canonicalized compound.