What is the molecular formula of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The molecular formula of methyl 3-amino-5-chloropyrazine-2-carboxylate is C6H6ClN3O2.
What are the synonyms of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The synonyms of methyl 3-amino-5-chloropyrazine-2-carboxylate include 28643-16-5, 2-Pyrazinecarboxylic acid, 3-amino-5-chloro-, methyl ester, MFCD11043614, and 3-AMINO-5-CHLORO-PYRAZINE-2-CARBOXYLIC ACID METHYL ESTER.
What is the molecular weight of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The molecular weight of methyl 3-amino-5-chloropyrazine-2-carboxylate is 187.58 g/mol.
When was methyl 3-amino-5-chloropyrazine-2-carboxylate created?
Methyl 3-amino-5-chloropyrazine-2-carboxylate was created on October 30, 2011.
When was methyl 3-amino-5-chloropyrazine-2-carboxylate last modified?
Methyl 3-amino-5-chloropyrazine-2-carboxylate was last modified on December 30, 2023.
What is the IUPAC name of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The IUPAC name of methyl 3-amino-5-chloropyrazine-2-carboxylate is methyl 3-amino-5-chloropyrazine-2-carboxylate.
What is the InChI of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The InChI of methyl 3-amino-5-chloropyrazine-2-carboxylate is InChI=1S/C6H6ClN3O2/c1-12-6(11)4-5(8)10-3(7)2-9-4/h2H,1H3,(H2,8,10).
What is the InChIKey of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The InChIKey of methyl 3-amino-5-chloropyrazine-2-carboxylate is XWKQJSXIVZCCKK-UHFFFAOYSA-N.
What is the canonical SMILES of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The canonical SMILES of methyl 3-amino-5-chloropyrazine-2-carboxylate is COC(=O)C1=NC=C(N=C1N)Cl.
What is the CAS number of methyl 3-amino-5-chloropyrazine-2-carboxylate?
The CAS number of methyl 3-amino-5-chloropyrazine-2-carboxylate is 28643-16-5.
※ Please kindly note that our products are for research use only.