What is the molecular formula of Methyl 2-methylglycidate?
The molecular formula of Methyl 2-methylglycidate is C5H8O3.
What are the synonyms for Methyl 2-methylglycidate?
The synonyms for Methyl 2-methylglycidate include methyl 2-methyloxirane-2-carboxylate, 58653-97-7, Oxiranecarboxylic acid, 2-methyl-, methyl ester, and 2-Methyoxirane-2-carboxylic acid, methyl ester.
What is the molecular weight of Methyl 2-methylglycidate?
The molecular weight of Methyl 2-methylglycidate is 116.11 g/mol.
What is the IUPAC name of Methyl 2-methylglycidate?
The IUPAC name of Methyl 2-methylglycidate is methyl 2-methyloxirane-2-carboxylate.
What is the InChI of Methyl 2-methylglycidate?
The InChI of Methyl 2-methylglycidate is InChI=1S/C5H8O3/c1-5(3-8-5)4(6)7-2/h3H2,1-2H3.
What is the InChIKey of Methyl 2-methylglycidate?
The InChIKey of Methyl 2-methylglycidate is OSYXXQUUGMLSGE-UHFFFAOYSA-N.
What is the Canonical SMILES of Methyl 2-methylglycidate?
The Canonical SMILES of Methyl 2-methylglycidate is CC1(CO1)C(=O)OC.
What is the CAS number of Methyl 2-methylglycidate?
The CAS number of Methyl 2-methylglycidate is 58653-97-7.
What is the XLogP3-AA value of Methyl 2-methylglycidate?
The XLogP3-AA value of Methyl 2-methylglycidate is 0.
Is Methyl 2-methylglycidate a canonicalized compound?
Yes, Methyl 2-methylglycidate is a canonicalized compound.