What is the molecular formula of mequitazine?
The molecular formula of mequitazine is C20H22N2S.
What is the molecular weight of mequitazine?
The molecular weight of mequitazine is 322.5 g/mol.
What is the IUPAC name of mequitazine?
The IUPAC name of mequitazine is 10-(1-azabicyclo[2.2.2]octan-3-ylmethyl)phenothiazine.
How does mequitazine function as a drug?
Mequitazine is a histamine H1 antagonist (antihistamine) that competes with histamine for H1-receptor sites, providing relief from allergic symptoms.
What is the InChIKey of mequitazine?
The InChIKey of mequitazine is HOKDBMAJZXIPGC-UHFFFAOYSA-N.
What is the Canonical SMILES representation of mequitazine?
The Canonical SMILES of mequitazine is C1CN2CCC1C(C2)CN3C4=CC=CC=C4SC5=CC=CC=C53.
What is the CAS number of mequitazine?
The CAS number of mequitazine is 29216-28-2.
How many hydrogen bond acceptors does mequitazine have?
Mequitazine has 3 hydrogen bond acceptors.
What is the topological polar surface area of mequitazine?
The topological polar surface area of mequitazine is 31.8 Ų.
What is the heavy atom count of mequitazine?
The heavy atom count of mequitazine is 23.