What is the PubChem CID of MADN?
PubChem CID: 53403806
What is the molecular formula of MADN?
Molecular Formula: C35H24
What are the synonyms of MADN?
Synonyms: 804560-00-7, 2-Methyl-9,10-di(naphthalen-2-yl)anthracene, MADN, 2-METHYL-9,10-BIS(NAPHTHALEN-2-YL)ANTHRACENE, 2-methyl-9,10-di(2-naphthyl)anthracene
What is the molecular weight of MADN?
Molecular Weight: 444.6 g/mol
When was MADN created?
Create Date: 2011-10-30
When was MADN last modified?
Modify Date: 2023-12-30
What is the IUPAC name of MADN?
IUPAC Name: 2-methyl-9,10-dinaphthalen-2-ylanthracene
What is the InChI of MADN?
InChI: InChI=1S/C35H24/c1-23-14-19-32-33(20-23)35(29-18-16-25-9-3-5-11-27(25)22-29)31-13-7-6-12-30(31)34(32)28-17-15-24-8-2-4-10-26(24)21-28/h2-22H,1H3
What is the InChIKey of MADN?
InChIKey: HNWFFTUWRIGBNM-UHFFFAOYSA-N
What is the Canonical SMILES of MADN?
Canonical SMILES: CC1=CC2=C(C3=CC=CC=C3C(=C2C=C1)C4=CC5=CC=CC=C5C=C4)C6=CC7=CC=CC=C7C=C6