What is the molecular formula of Lodoxamide?
The molecular formula of Lodoxamide is C11H6ClN3O6.
What is the molecular weight of Lodoxamide?
The molecular weight of Lodoxamide is 311.63 g/mol.
What is Lodoxamide used for?
Lodoxamide is a mast-cell stabilizer for topical administration into the eye, used in the treatment of ocular hypersensitivity reactions.
What is the brand name under which Lodoxamide is marketed?
Lodoxamide is marketed under the brand name Alomide by Alcon.
What is the physiological effect of Lodoxamide?
The physiologic effect of Lodoxamide is by means of Decreased Histamine Release.
What is the InChIKey of Lodoxamide?
The InChIKey of Lodoxamide is RVGLGHVJXCETIO-UHFFFAOYSA-N.
What is the canonical SMILES representation of Lodoxamide?
The canonical SMILES representation of Lodoxamide is C1=C(C=C(C(=C1NC(=O)C(=O)O)Cl)NC(=O)C(=O)O)C#N.
What is the CAS number of Lodoxamide?
The CAS number of Lodoxamide is 53882-12-5.
How many hydrogen bond donor counts are there in Lodoxamide?
There are 4 hydrogen bond donor counts in Lodoxamide.
What is the XLogP3-AA value of Lodoxamide?
The XLogP3-AA value of Lodoxamide is 0.5.