What is the molecular formula of Ladostigil?
The molecular formula of Ladostigil is C16H20N2O2.
What is the molecular weight of Ladostigil?
The molecular weight of Ladostigil is 272.34 g/mol.
What is the IUPAC Name of Ladostigil?
The IUPAC Name of Ladostigil is [(3R)-3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-ethyl-N-methylcarbamate.
What is the InChIKey of Ladostigil?
The InChIKey of Ladostigil is LHXOCOHMBFOVJS-OAHLLOKOSA-N.
What is the Canonical SMILES of Ladostigil?
The Canonical SMILES of Ladostigil is CCN(C)C(=O)OC1=CC2=C(CCC2NCC#C)C=C1.
What is the CAS number of Ladostigil?
The CAS number of Ladostigil is 209394-27-4.
What is the XLogP3-AA value of Ladostigil?
The XLogP3-AA value of Ladostigil is 2.
How many Hydrogen Bond Donor Count does Ladostigil have?
Ladostigil has 1 Hydrogen Bond Donor Count.
What is the Rotatable Bond Count of Ladostigil?
The Rotatable Bond Count of Ladostigil is 5.
How many Defined Atom Stereocenter Count does Ladostigil have?
Ladostigil has 1 Defined Atom Stereocenter Count.