What is the PubChem CID of L-(-)-p-Bromotetramisole oxalate?
The PubChem CID of L-(-)-p-Bromotetramisole oxalate is 2724023.
What is the molecular formula of L-(-)-p-Bromotetramisole oxalate?
The molecular formula of L-(-)-p-Bromotetramisole oxalate is C13H13BrN2O4S.
What is the molecular weight of L-(-)-p-Bromotetramisole oxalate?
The molecular weight of L-(-)-p-Bromotetramisole oxalate is 373.22 g/mol.
What is the IUPAC name of L-(-)-p-Bromotetramisole oxalate?
The IUPAC name of L-(-)-p-Bromotetramisole oxalate is (6S)-6-(4-bromophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole;oxalic acid.
What is the InChI of L-(-)-p-Bromotetramisole oxalate?
The InChI of L-(-)-p-Bromotetramisole oxalate is InChI=1S/C11H11BrN2S.C2H2O4/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10;3-1(4)2(5)6/h1-4,10H,5-7H2;(H,3,4)(H,5,6)/t10-;/m1./s1.
What is the InChIKey of L-(-)-p-Bromotetramisole oxalate?
The InChIKey of L-(-)-p-Bromotetramisole oxalate is ZULBIBHDIQCNIS-HNCPQSOCSA-N.
What is the canonical SMILES of L-(-)-p-Bromotetramisole oxalate?
The canonical SMILES of L-(-)-p-Bromotetramisole oxalate is C1CSC2=NC(CN21)C3=CC=C(C=C3)Br.C(=O)(C(=O)O)O.
What is the CAS number of L-(-)-p-Bromotetramisole oxalate?
The CAS number of L-(-)-p-Bromotetramisole oxalate is 62284-79-1.
What is the European Community (EC) number of L-(-)-p-Bromotetramisole oxalate?
The European Community (EC) number of L-(-)-p-Bromotetramisole oxalate is 263-487-0.
※ Please kindly note that our products are for research use only.