What is the molecular formula of L-cysteine?
The molecular formula of L-cysteine is C3H7NO2S.
What is the molecular weight of L-cysteine?
The molecular weight of L-cysteine is 121.16 g/mol.
What is the IUPAC name of L-cysteine?
The IUPAC name of L-cysteine is (2R)-2-amino-3-sulfanylpropanoic acid.
What is the InChI of L-cysteine?
The InChI of L-cysteine is InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1.
What is the InChIKey of L-cysteine?
The InChIKey of L-cysteine is XUJNEKJLAYXESH-REOHCLBHSA-N.
What is the canonical SMILES of L-cysteine?
The canonical SMILES of L-cysteine is C(C(C(=O)O)N)S.
What is the CAS number of L-cysteine?
The CAS number of L-cysteine is 52-90-4.
What is the ChEBI ID of L-cysteine?
The ChEBI ID of L-cysteine is CHEBI863.
What is the FEMA number of L-cysteine?
The FEMA number of L-cysteine is 3263.
What is the KEGG ID of L-cysteine?
The KEGG ID of L-cysteine is C00097.