What is the PubChem CID of Julolidine?
The PubChem CID of Julolidine is 68069.
What is the molecular formula of Julolidine?
The molecular formula of Julolidine is C12H15N.
What are the synonyms of Julolidine?
The synonyms of Julolidine are 1,2,3,5,6,7-Hexahydropyrido[3,2,1-ij]quinoline and 2,3,6,7-Tetrahydro-1H,5H-benzo[ij]quinolizine.
What is the molecular weight of Julolidine?
The molecular weight of Julolidine is 173.25 g/mol.
What is the IUPAC name of Julolidine?
The IUPAC name of Julolidine is 1-azatricyclo[7.3.1.0 5,13 ]trideca-5(13),6,8-triene.
What is the InChI of Julolidine?
The InChI of Julolidine is InChI=1S/C12H15N/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13/h1,4-5H,2-3,6-9H2.
What is the InChIKey of Julolidine?
The InChIKey of Julolidine is DZFWNZJKBJOGFQ-UHFFFAOYSA-N.
What is the canonical SMILES of Julolidine?
The canonical SMILES of Julolidine is C1CC2=C3C(=CC=C2)CCCN3C1.
What is the CAS number of Julolidine?
The CAS number of Julolidine is 479-59-4.
What is the European Community (EC) number of Julolidine?
The European Community (EC) number of Julolidine is 207-535-0.