What is the molecular formula of isopropylcyclohexane?
The molecular formula of isopropylcyclohexane is C9H18.
What is the molecular weight of isopropylcyclohexane?
The molecular weight of isopropylcyclohexane is 126.24 g/mol.
What is the IUPAC name of isopropylcyclohexane?
The IUPAC name of isopropylcyclohexane is propan-2-ylcyclohexane.
What is the InChI of isopropylcyclohexane?
The InChI of isopropylcyclohexane is InChI=1S/C9H18/c1-8(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3.
What is the InChIKey of isopropylcyclohexane?
The InChIKey of isopropylcyclohexane is GWESVXSMPKAFAS-UHFFFAOYSA-N.
What is the canonical SMILES of isopropylcyclohexane?
The canonical SMILES of isopropylcyclohexane is CC(C)C1CCCCC1.
What is the CAS number of isopropylcyclohexane?
The CAS number of isopropylcyclohexane is 696-29-7.
What is the UNII of isopropylcyclohexane?
The UNII of isopropylcyclohexane is 5S52JAD8P7.
What is the DSSTox Substance ID of isopropylcyclohexane?
The DSSTox Substance ID of isopropylcyclohexane is DTXSID2061012.
What is the complexity of isopropylcyclohexane?
The complexity of isopropylcyclohexane is 68.1.