What is the molecular formula of isoflavone?
The molecular formula of isoflavone is C15H10O2.
What is the molecular weight of isoflavone?
The molecular weight of isoflavone is 222.24 g/mol.
How is isoflavone described in terms of its structure and chemical composition?
Isoflavone is described as the simplest member of the class of isoflavones that is 4H-chromen-4-one in which the hydrogen at position 3 is replaced by a phenyl group.
What are some synonyms of isoflavone?
Some synonyms of isoflavone include 3-phenyl-4H-chromen-4-one, 3-phenylchromen-4-one, and 4H-1-Benzopyran-4-one, 3-phenyl-.
In which organisms is isoflavone naturally found?
Isoflavone is naturally found in Astragalus mongholicus, Medicago sativa, and other organisms with available data.
What is the IUPAC name of isoflavone?
The IUPAC name of isoflavone is 3-phenylchromen-4-one.
What is the InChI code of isoflavone?
The InChI code of isoflavone is InChI=1S/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H.
What is the InChIKey of isoflavone?
The InChIKey of isoflavone is GOMNOOKGLZYEJT-UHFFFAOYSA-N.
What is the canonical SMILES representation of isoflavone?
The canonical SMILES representation of isoflavone is C1=CC=C(C=C1)C2=COC3=CC=CC=C3C2=O.
What is the CAS number of isoflavone?
The CAS number of isoflavone is 574-12-9.